About 2-pyridin-4-yl-1,4-dihydroquinazoline
2-pyridin-4-yl-1,4-dihydroquinazoline (PubChem CID 90785207) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-pyridin-4-yl-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 2-pyridin-4-yl-1,4-dihydroquinazoline |
| PubChem CID | 90785207 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-pyridin-4-yl-1,4-dihydroquinazoline |
| SMILES | c1ccc2c(c1)CN=C(c1ccncc1)N2 |
| InChI | InChI=1S/C13H11N3/c1-2-4-12-11(3-1)9-15-13(16-12)10-5-7-14-8-6-10/h1-8H,9H2,(H,15,16) |
| InChIKey | RYMPFEYVHMSOKK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-4-yl-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-yl-1,4-dihydroquinazoline?
The IUPAC name of 2-pyridin-4-yl-1,4-dihydroquinazoline (CID 90785207) is 2-pyridin-4-yl-1,4-dihydroquinazoline.
What is the SMILES notation for 2-pyridin-4-yl-1,4-dihydroquinazoline?
The canonical SMILES for 2-pyridin-4-yl-1,4-dihydroquinazoline is c1ccc2c(c1)CN=C(c1ccncc1)N2.
What is the InChIKey of 2-pyridin-4-yl-1,4-dihydroquinazoline?
The InChIKey is RYMPFEYVHMSOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c1-2-4-12-11(3-1)9-15-13(16-12)10-5-7-14-8-6-10/h1-8H,9H2,(H,15,16).
What are the key properties of 2-pyridin-4-yl-1,4-dihydroquinazoline?
2-pyridin-4-yl-1,4-dihydroquinazoline has a molecular weight of 209.25 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-yl-1,4-dihydroquinazoline is sourced from PubChem (CID 90785207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).