C12H12N2O4S — CID 90785271
6-but-2-enyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid (PubChem CID 90785271) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 6-but-2-enyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid.
| Compound Name | 6-but-2-enyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90785271 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 6-but-2-enyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
| SMILES | CC=CCn1c(=O)c(C)c2sc(C(=O)O)cn2c1=O |
| InChI | InChI=1S/C12H12N2O4S/c1-3-4-5-13-9(15)7(2)10-14(12(13)18)6-8(19-10)11(16)17/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | QYEPEXMRKOSKMP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|