About (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate
(1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate (PubChem CID 90785787) has the molecular formula C28H33N3O4
and a molecular weight of 475.59 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate.
Molecular Properties
| Compound Name | (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate |
| PubChem CID | 90785787 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate |
| SMILES | CC(=O)c1ccc(-c2nc3ccccc3n2C(CC(C)C)C(=O)OC2(C(N)=O)CCCCC2)cc1 |
| InChI | InChI=1S/C28H33N3O4/c1-18(2)17-24(26(33)35-28(27(29)34)15-7-4-8-16-28)31-23-10-6-5-9-22(23)30-25(31)21-13-11-20(12-14-21)19(3)32/h5-6,9-14,18,24H,4,7-8,15-17H2,1-3H3,(H2,29,34) |
| InChIKey | VERYLUBRDSHXGK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate?
The IUPAC name of (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate (CID 90785787) is (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate.
What is the SMILES notation for (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate?
The canonical SMILES for (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate is CC(=O)c1ccc(-c2nc3ccccc3n2C(CC(C)C)C(=O)OC2(C(N)=O)CCCCC2)cc1.
What is the InChIKey of (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate?
The InChIKey is VERYLUBRDSHXGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33N3O4/c1-18(2)17-24(26(33)35-28(27(29)34)15-7-4-8-16-28)31-23-10-6-5-9-22(23)30-25(31)21-13-11-20(12-14-21)19(3)32/h5-6,9-14,18,24H,4,7-8,15-17H2,1-3H3,(H2,29,34).
What are the key properties of (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate?
(1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate has a molecular weight of 475.59 g/mol, XLogP of 5.22, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclohexyl) 2-[2-(4-acetylphenyl)benzimidazol-1-yl]-4-methylpentanoate is sourced from PubChem (CID 90785787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).