C12H22N2 — CID 90786085
3,3-dimethyl-5-N-(2-methylpropylidene)hex-4-ene-1,5-diimine (PubChem CID 90786085) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 3,3-dimethyl-5-N-(2-methylpropylidene)hex-4-ene-1,5-diimine.
| Compound Name | 3,3-dimethyl-5-N-(2-methylpropylidene)hex-4-ene-1,5-diimine |
|---|---|
| PubChem CID | 90786085 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3,3-dimethyl-5-N-(2-methylpropylidene)hex-4-ene-1,5-diimine |
| SMILES | [H]/N=C/CC(C)(C)C=C(C)/N=C/C(C)C |
| InChI | InChI=1S/C12H22N2/c1-10(2)9-14-11(3)8-12(4,5)6-7-13/h7-10,13H,6H2,1-5H3/b11-8?,13-7+,14-9+ |
| InChIKey | UMECTXJCYDKGEX-MZSVXARBSA-N |
| XLogP | 3.68 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|