C33H47NO12 — CID 90787060
(1,2,4,9-tetrahydroxy-10,14,17-trimethyl-11,12-dioxo-6-oxatricyclo[11.3.1.04,7]heptadecan-15-yl) 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 90787060) has the molecular formula C33H47NO12 and a molecular weight of 649.73 g/mol. Its IUPAC name is (1,2,4,9-tetrahydroxy-10,14,17-trimethyl-11,12-dioxo-6-oxatricyclo[11.3.1.04,7]heptadecan-15-yl) 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | (1,2,4,9-tetrahydroxy-10,14,17-trimethyl-11,12-dioxo-6-oxatricyclo[11.3.1.04,7]heptadecan-15-yl) 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 90787060 |
| Molecular Formula | C33H47NO12 |
| Molecular Weight | 649.73 g/mol |
| Exact Mass | 649.31 |
| IUPAC Name | (1,2,4,9-tetrahydroxy-10,14,17-trimethyl-11,12-dioxo-6-oxatricyclo[11.3.1.04,7]heptadecan-15-yl) 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | CC1C(=O)C(=O)C2C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c3ccccc3)CC(O)(C(O)CC3(O)COC3CC1O)C2C |
| InChI | InChI=1S/C33H47NO12/c1-16-20(35)12-23-32(42,15-44-23)14-22(36)33(43)13-21(17(2)24(18(33)3)27(38)26(16)37)45-29(40)28(39)25(19-10-8-7-9-11-19)34-30(41)46-31(4,5)6/h7-11,16-18,20-25,28,35-36,39,42-43H,12-15H2,1-6H3,(H,34,41) |
| InChIKey | RERVKXREJIBTTA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 209.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.73 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|