C24H34BrNSi — CID 90787098
(5-bromo-7-methyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane (PubChem CID 90787098) has the molecular formula C24H34BrNSi and a molecular weight of 444.53 g/mol. Its IUPAC name is (5-bromo-7-methyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane.
| Compound Name | (5-bromo-7-methyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 90787098 |
| Molecular Formula | C24H34BrNSi |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (5-bromo-7-methyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1CC2C(Br)C3CCCNC3CC2C1[Si](C)(C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C24H34BrNSi/c1-15-13-19-20(14-21-18(23(19)25)9-6-12-26-21)24(15)27(2,3)22-11-10-16-7-4-5-8-17(16)22/h4-5,7-8,10-11,15,18-24,26H,6,9,12-14H2,1-3H3 |
| InChIKey | GXXLEJDVPZALCN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|