C28H53NO6P+ — CID 90787461
2-[[(2S)-1,2-dihydroxytricosa-8,11,14,17-tetraen-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 90787461) has the molecular formula C28H53NO6P+ and a molecular weight of 530.71 g/mol. Its IUPAC name is 2-[[(2S)-1,2-dihydroxytricosa-8,11,14,17-tetraen-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2S)-1,2-dihydroxytricosa-8,11,14,17-tetraen-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 90787461 |
| Molecular Formula | C28H53NO6P+ |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 2-[[(2S)-1,2-dihydroxytricosa-8,11,14,17-tetraen-3-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCC(OP(=O)(O)OCC[N+](C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C28H52NO6P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(27(31)26-30)35-36(32,33)34-25-24-29(2,3)4/h9-10,12-13,15-16,18-19,27-28,30-31H,5-8,11,14,17,20-26H2,1-4H3/p+1/t27-,28?/m0/s1 |
| InChIKey | ZEHUMPWYRKIATH-MBMZGMDYSA-O |
| XLogP | 6.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|