C8H5N3 — CID 90787556
4,10,11-triazatricyclo[6.2.1.02,7]undeca-1(10),2(7),3,5,8-pentaene (PubChem CID 90787556) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 4,10,11-triazatricyclo[6.2.1.02,7]undeca-1(10),2(7),3,5,8-pentaene.
| Compound Name | 4,10,11-triazatricyclo[6.2.1.02,7]undeca-1(10),2(7),3,5,8-pentaene |
|---|---|
| PubChem CID | 90787556 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 4,10,11-triazatricyclo[6.2.1.02,7]undeca-1(10),2(7),3,5,8-pentaene |
| SMILES | c1cc2c3cnc([nH]3)c2cn1 |
| InChI | InChI=1S/C8H5N3/c1-2-9-3-6-5(1)7-4-10-8(6)11-7/h1-4H,(H,10,11) |
| InChIKey | JJZXUSCPOSJHAN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |