C30H58O9 — CID 90788135
7-[2-[3-(1,6-dihydroxyhexyl)-4,9-dihydroxynon-1-enoxy]ethenyl]tridecane-1,6,8,13-tetrol (PubChem CID 90788135) has the molecular formula C30H58O9 and a molecular weight of 562.79 g/mol. Its IUPAC name is 7-[2-[3-(1,6-dihydroxyhexyl)-4,9-dihydroxynon-1-enoxy]ethenyl]tridecane-1,6,8,13-tetrol.
| Compound Name | 7-[2-[3-(1,6-dihydroxyhexyl)-4,9-dihydroxynon-1-enoxy]ethenyl]tridecane-1,6,8,13-tetrol |
|---|---|
| PubChem CID | 90788135 |
| Molecular Formula | C30H58O9 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | 7-[2-[3-(1,6-dihydroxyhexyl)-4,9-dihydroxynon-1-enoxy]ethenyl]tridecane-1,6,8,13-tetrol |
| SMILES | OCCCCCC(O)C(C=COC=CC(C(O)CCCCCO)C(O)CCCCCO)C(O)CCCCCO |
| InChI | InChI=1S/C30H58O9/c31-19-9-1-5-13-27(35)25(28(36)14-6-2-10-20-32)17-23-39-24-18-26(29(37)15-7-3-11-21-33)30(38)16-8-4-12-22-34/h17-18,23-38H,1-16,19-22H2 |
| InChIKey | CZTGEQYOVPCYSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|