About 4-ethoxy-N-fluorobutanamide;molecular fluorine
4-ethoxy-N-fluorobutanamide;molecular fluorine (PubChem CID 90788571) has the molecular formula C6H12F9NO2
and a molecular weight of 301.15 g/mol. Its IUPAC name is 4-ethoxy-N-fluorobutanamide;molecular fluorine.
Molecular Properties
| Compound Name | 4-ethoxy-N-fluorobutanamide;molecular fluorine |
| PubChem CID | 90788571 |
| Molecular Formula | C6H12F9NO2 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-ethoxy-N-fluorobutanamide;molecular fluorine |
| SMILES | CCOCCCC(=O)NF.FF.FF.FF.FF |
| InChI | InChI=1S/C6H12FNO2.4F2/c1-2-10-5-3-4-6(9)8-7;4*1-2/h2-5H2,1H3,(H,8,9);;;; |
| InChIKey | IMGYFWXPSXVYBV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N-fluorobutanamide;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-fluorobutanamide;molecular fluorine?
The IUPAC name of 4-ethoxy-N-fluorobutanamide;molecular fluorine (CID 90788571) is 4-ethoxy-N-fluorobutanamide;molecular fluorine.
What is the SMILES notation for 4-ethoxy-N-fluorobutanamide;molecular fluorine?
The canonical SMILES for 4-ethoxy-N-fluorobutanamide;molecular fluorine is CCOCCCC(=O)NF.FF.FF.FF.FF.
What is the InChIKey of 4-ethoxy-N-fluorobutanamide;molecular fluorine?
The InChIKey is IMGYFWXPSXVYBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO2.4F2/c1-2-10-5-3-4-6(9)8-7;4*1-2/h2-5H2,1H3,(H,8,9);;;;.
What are the key properties of 4-ethoxy-N-fluorobutanamide;molecular fluorine?
4-ethoxy-N-fluorobutanamide;molecular fluorine has a molecular weight of 301.15 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-fluorobutanamide;molecular fluorine is sourced from PubChem (CID 90788571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).