C22H26F3N7O2S — CID 90788602
N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide (PubChem CID 90788602) has the molecular formula C22H26F3N7O2S and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 90788602 |
| Molecular Formula | C22H26F3N7O2S |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
| SMILES | [H]/N=C(\C)CC(N)=Nc1cc(N2CCC(O)CC2)nc(Sc2ccc(NC(=O)CC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C22H26F3N7O2S/c1-13(26)10-17(27)29-18-11-19(32-8-6-15(33)7-9-32)31-21(30-18)35-16-4-2-14(3-5-16)28-20(34)12-22(23,24)25/h2-5,11,15,26,33H,6-10,12H2,1H3,(H,28,34)(H2,27,29,30,31)/b26-13+ |
| InChIKey | ZDEGDNKFEOWRRE-LGJNPRDNSA-N |
| XLogP | 3.90 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|