C18H14N6O3 — CID 90788686
methyl 2-oxo-3-[[4-(2H-tetrazol-5-yl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxylate (PubChem CID 90788686) has the molecular formula C18H14N6O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is methyl 2-oxo-3-[[4-(2H-tetrazol-5-yl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 2-oxo-3-[[4-(2H-tetrazol-5-yl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90788686 |
| Molecular Formula | C18H14N6O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 2-oxo-3-[[4-(2H-tetrazol-5-yl)phenyl]iminomethyl]-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C=N/c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H14N6O3/c1-27-18(26)11-4-7-13-14(17(25)20-15(13)8-11)9-19-12-5-2-10(3-6-12)16-21-23-24-22-16/h2-9,14H,1H3,(H,20,25)(H,21,22,23,24)/b19-9+ |
| InChIKey | AJATXZCBISSKQI-DJKKODMXSA-N |
| XLogP | 2.09 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|