C24H25Cl2NO2 — CID 90788704
(3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(2,3-dichlorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 90788704) has the molecular formula C24H25Cl2NO2 and a molecular weight of 430.38 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(2,3-dichlorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(2,3-dichlorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 90788704 |
| Molecular Formula | C24H25Cl2NO2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(2,3-dichlorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3cccc(Cl)c3Cl)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C24H25Cl2NO2/c1-13-11-20-22(15(3)29-24(20)28)18(14(13)2)10-9-17-8-7-16(12-27-17)19-5-4-6-21(25)23(19)26/h4-10,12-15,18,20,22H,11H2,1-3H3/t13-,14+,15+,18-,20+,22-/m0/s1 |
| InChIKey | ZKGKFYMTEOBLRP-KBKGSGHLSA-N |
| XLogP | 6.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |