About 1,5-dimethylindazole;ethane
1,5-dimethylindazole;ethane (PubChem CID 90788862) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1,5-dimethylindazole;ethane.
Molecular Properties
| Compound Name | 1,5-dimethylindazole;ethane |
| PubChem CID | 90788862 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1,5-dimethylindazole;ethane |
| SMILES | CC.CC.Cc1ccc2c(cnn2C)c1 |
| InChI | InChI=1S/C9H10N2.2C2H6/c1-7-3-4-9-8(5-7)6-10-11(9)2;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | QWZXFYMNZBRXEW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethylindazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylindazole;ethane?
The IUPAC name of 1,5-dimethylindazole;ethane (CID 90788862) is 1,5-dimethylindazole;ethane.
What is the SMILES notation for 1,5-dimethylindazole;ethane?
The canonical SMILES for 1,5-dimethylindazole;ethane is CC.CC.Cc1ccc2c(cnn2C)c1.
What is the InChIKey of 1,5-dimethylindazole;ethane?
The InChIKey is QWZXFYMNZBRXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.2C2H6/c1-7-3-4-9-8(5-7)6-10-11(9)2;2*1-2/h3-6H,1-2H3;2*1-2H3.
What are the key properties of 1,5-dimethylindazole;ethane?
1,5-dimethylindazole;ethane has a molecular weight of 206.33 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylindazole;ethane is sourced from PubChem (CID 90788862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).