C32H56 — CID 90789008
2-[2-[3-(2-butan-2-yl-5-methyl-5-bicyclo[2.1.0]pentanyl)-4-methylhexan-2-yl]cyclopropyl]-2-methyl-5,5-di(propan-2-yl)bicyclo[2.1.0]pentane (PubChem CID 90789008) has the molecular formula C32H56 and a molecular weight of 440.80 g/mol. Its IUPAC name is 2-[2-[3-(2-butan-2-yl-5-methyl-5-bicyclo[2.1.0]pentanyl)-4-methylhexan-2-yl]cyclopropyl]-2-methyl-5,5-di(propan-2-yl)bicyclo[2.1.0]pentane.
| Compound Name | 2-[2-[3-(2-butan-2-yl-5-methyl-5-bicyclo[2.1.0]pentanyl)-4-methylhexan-2-yl]cyclopropyl]-2-methyl-5,5-di(propan-2-yl)bicyclo[2.1.0]pentane |
|---|---|
| PubChem CID | 90789008 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | 2-[2-[3-(2-butan-2-yl-5-methyl-5-bicyclo[2.1.0]pentanyl)-4-methylhexan-2-yl]cyclopropyl]-2-methyl-5,5-di(propan-2-yl)bicyclo[2.1.0]pentane |
| SMILES | CCC(C)C1CC2C1C2(C)C(C(C)CC)C(C)C1CC1C1(C)CC2C1C2(C(C)C)C(C)C |
| InChI | InChI=1S/C32H56/c1-12-19(7)22-14-25-28(22)31(25,11)27(20(8)13-2)21(9)23-15-24(23)30(10)16-26-29(30)32(26,17(3)4)18(5)6/h17-29H,12-16H2,1-11H3 |
| InChIKey | VCVGSCOCEWLVFX-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |