C10H10N2O2 — CID 90789310
4-(2,5-dihydro-1,2-oxazol-3-yl)benzamide (PubChem CID 90789310) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-(2,5-dihydro-1,2-oxazol-3-yl)benzamide.
| Compound Name | 4-(2,5-dihydro-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 90789310 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-(2,5-dihydro-1,2-oxazol-3-yl)benzamide |
| SMILES | NC(=O)c1ccc(C2=CCON2)cc1 |
| InChI | InChI=1S/C10H10N2O2/c11-10(13)8-3-1-7(2-4-8)9-5-6-14-12-9/h1-5,12H,6H2,(H2,11,13) |
| InChIKey | YIJGJFBEJZBGMX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |