About 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione
4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 90789385) has the molecular formula C27H25FN2O3
and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
Molecular Properties
| Compound Name | 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| PubChem CID | 90789385 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | CCc1ccc(Oc2cnc3cc(F)ccc3n2)cc1C1C(=O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C27H25FN2O3/c1-2-14-7-9-18(33-22-13-29-21-11-17(28)8-10-20(21)30-22)12-19(14)25-26(31)23-15-3-4-16(6-5-15)24(23)27(25)32/h7-13,15-16,23-25H,2-6H2,1H3 |
| InChIKey | QIVRZPXHWHAIAC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione?
The IUPAC name of 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (CID 90789385) is 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
What is the SMILES notation for 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione?
The canonical SMILES for 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione is CCc1ccc(Oc2cnc3cc(F)ccc3n2)cc1C1C(=O)C2C3CCC(CC3)C2C1=O.
What is the InChIKey of 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione?
The InChIKey is QIVRZPXHWHAIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25FN2O3/c1-2-14-7-9-18(33-22-13-29-21-11-17(28)8-10-20(21)30-22)12-19(14)25-26(31)23-15-3-4-16(6-5-15)24(23)27(25)32/h7-13,15-16,23-25H,2-6H2,1H3.
What are the key properties of 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione?
4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione has a molecular weight of 444.51 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-ethyl-5-(6-fluoroquinoxalin-2-yl)oxyphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione is sourced from PubChem (CID 90789385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).