C23H26FN7O2 — CID 90789678
5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]-2-propylphenol (PubChem CID 90789678) has the molecular formula C23H26FN7O2 and a molecular weight of 451.51 g/mol. Its IUPAC name is 5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]-2-propylphenol.
| Compound Name | 5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]-2-propylphenol |
|---|---|
| PubChem CID | 90789678 |
| Molecular Formula | C23H26FN7O2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 5-[[6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-pyridinyl]amino]-2-propylphenol |
| SMILES | CCCc1ccc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)cc1O |
| InChI | InChI=1S/C23H26FN7O2/c1-2-3-16-4-5-17(12-21(16)32)28-19-7-6-18(25-13-19)14-27-30-23-26-15-20(24)22(29-23)31-8-10-33-11-9-31/h4-7,12-13,15,28,32H,2-3,8-11,14H2,1H3/b30-27+ |
| InChIKey | HWYUULRRXXSLIM-KDJFERLWSA-N |
| XLogP | 4.53 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|