C20H23ClN2O5 — CID 9078972
[2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 9078972) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9078972 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methyl-ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)C(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C20H23ClN2O5/c1-4-23(11-13-5-8-17(26-2)18(9-13)27-3)19(24)12-28-20(25)14-6-7-15(21)16(22)10-14/h5-10H,4,11-12,22H2,1-3H3 |
| InChIKey | AMLZCXLACNUKCZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|