C34H44N6O2 — CID 90789769
ethyl 7-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]heptanoate (PubChem CID 90789769) has the molecular formula C34H44N6O2 and a molecular weight of 568.77 g/mol. Its IUPAC name is ethyl 7-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]heptanoate.
| Compound Name | ethyl 7-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 90789769 |
| Molecular Formula | C34H44N6O2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | ethyl 7-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1CCN(Cc2ccc(-c3cc4c(NC(C)c5ccccc5)ncnc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C34H44N6O2/c1-3-42-32(41)13-9-4-5-10-18-39-19-21-40(22-20-39)24-27-14-16-29(17-15-27)31-23-30-33(35-25-36-34(30)38-31)37-26(2)28-11-7-6-8-12-28/h6-8,11-12,14-17,23,25-26H,3-5,9-10,13,18-22,24H2,1-2H3,(H2,35,36,37,38) |
| InChIKey | TZZBYRIUWGRMGR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|