About (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate
(2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate (PubChem CID 90789883) has the molecular formula C11H13NO6S
and a molecular weight of 287.29 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate |
| PubChem CID | 90789883 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate |
| SMILES | O=C1CC2CCC12CS(=O)(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H13NO6S/c13-8-5-7-3-4-11(7,8)6-19(16,17)18-12-9(14)1-2-10(12)15/h1-2,7,14-15H,3-6H2 |
| InChIKey | FNDXSDOQYQBBSQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate (CID 90789883) is (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate is O=C1CC2CCC12CS(=O)(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate?
The InChIKey is FNDXSDOQYQBBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO6S/c13-8-5-7-3-4-11(7,8)6-19(16,17)18-12-9(14)1-2-10(12)15/h1-2,7,14-15H,3-6H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate?
(2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate has a molecular weight of 287.29 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) (2-oxo-1-bicyclo[2.2.0]hexanyl)methanesulfonate is sourced from PubChem (CID 90789883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).