C9H7N3O2S — CID 90789989
3,8-dihydro-1H-imidazo[4,5-g][1,4]benzothiazine-2,7-dione (PubChem CID 90789989) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 3,8-dihydro-1H-imidazo[4,5-g][1,4]benzothiazine-2,7-dione.
| Compound Name | 3,8-dihydro-1H-imidazo[4,5-g][1,4]benzothiazine-2,7-dione |
|---|---|
| PubChem CID | 90789989 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 3,8-dihydro-1H-imidazo[4,5-g][1,4]benzothiazine-2,7-dione |
| SMILES | O=C1CSc2cc3[nH]c(=O)[nH]c3cc2N1 |
| InChI | InChI=1S/C9H7N3O2S/c13-8-3-15-7-2-5-4(1-6(7)10-8)11-9(14)12-5/h1-2H,3H2,(H,10,13)(H2,11,12,14) |
| InChIKey | NYXFSGSAVMRACO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |