About tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate
tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 90790440) has the molecular formula C15H27NO5
and a molecular weight of 301.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| PubChem CID | 90790440 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO5/c1-10(13(17)20-6)12(19-5)11-8-7-9-16(11)14(18)21-15(2,3)4/h10-12H,7-9H2,1-6H3/t10-,11+,12-/m1/s1 |
| InChIKey | OUDIZTOACCWIRY-GRYCIOLGSA-N |
| XLogP | 2.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (CID 90790440) is tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate is COC(=O)[C@H](C)[C@@H](OC)[C@@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
The InChIKey is OUDIZTOACCWIRY-GRYCIOLGSA-N. The full InChI is InChI=1S/C15H27NO5/c1-10(13(17)20-6)12(19-5)11-8-7-9-16(11)14(18)21-15(2,3)4/h10-12H,7-9H2,1-6H3/t10-,11+,12-/m1/s1.
What are the key properties of tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate has a molecular weight of 301.38 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(1R,2R)-1,3-dimethoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 90790440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).