C42H38N4O4 — CID 90790488
ethyl 2,5-bis[(9-ethylcarbazol-3-yl)-methylamino]-4-(3-oxoprop-2-enoyl)benzoate (PubChem CID 90790488) has the molecular formula C42H38N4O4 and a molecular weight of 662.79 g/mol. Its IUPAC name is ethyl 2,5-bis[(9-ethylcarbazol-3-yl)-methylamino]-4-(3-oxoprop-2-enoyl)benzoate.
| Compound Name | ethyl 2,5-bis[(9-ethylcarbazol-3-yl)-methylamino]-4-(3-oxoprop-2-enoyl)benzoate |
|---|---|
| PubChem CID | 90790488 |
| Molecular Formula | C42H38N4O4 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | ethyl 2,5-bis[(9-ethylcarbazol-3-yl)-methylamino]-4-(3-oxoprop-2-enoyl)benzoate |
| SMILES | CCOC(=O)c1cc(N(C)c2ccc3c(c2)c2ccccc2n3CC)c(C(=O)C=C=O)cc1N(C)c1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C42H38N4O4/c1-6-45-35-15-11-9-13-29(35)31-23-27(17-19-37(31)45)43(4)39-26-34(42(49)50-8-3)40(25-33(39)41(48)21-22-47)44(5)28-18-20-38-32(24-28)30-14-10-12-16-36(30)46(38)7-2/h9-21,23-26H,6-8H2,1-5H3 |
| InChIKey | XQAUSVPDIIRUEI-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 76.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|