C25H38FNO5 — CID 90790888
ethyl 7-[(1R,2R,5S)-2-[(3R)-5-(4-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate (PubChem CID 90790888) has the molecular formula C25H38FNO5 and a molecular weight of 451.58 g/mol. Its IUPAC name is ethyl 7-[(1R,2R,5S)-2-[(3R)-5-(4-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2R,5S)-2-[(3R)-5-(4-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 90790888 |
| Molecular Formula | C25H38FNO5 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | ethyl 7-[(1R,2R,5S)-2-[(3R)-5-(4-fluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCC[C@H]1[C@@H](O)CC(N=O)[C@@H]1CC[C@@H](O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H38FNO5/c1-2-32-25(30)8-6-4-3-5-7-22-21(23(27-31)17-24(22)29)16-15-20(28)14-11-18-9-12-19(26)13-10-18/h9-10,12-13,20-24,28-29H,2-8,11,14-17H2,1H3/t20-,21+,22+,23?,24-/m0/s1 |
| InChIKey | AWJPGEXCIUAWOE-ZQQLMHMHSA-N |
| XLogP | 4.94 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|