About 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide
2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide (PubChem CID 90791952) has the molecular formula C11H10N4O4S2
and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide |
| PubChem CID | 90791952 |
| Molecular Formula | C11H10N4O4S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(N)=O)c1NS(=O)(=O)c1cscn1 |
| InChI | InChI=1S/C11H10N4O4S2/c12-10(16)6-2-1-3-7(11(13)17)9(6)15-21(18,19)8-4-20-5-14-8/h1-5,15H,(H2,12,16)(H2,13,17) |
| InChIKey | JALGWBVSXNDKQC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide?
The IUPAC name of 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide (CID 90791952) is 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide.
What is the SMILES notation for 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide?
The canonical SMILES for 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide is NC(=O)c1cccc(C(N)=O)c1NS(=O)(=O)c1cscn1.
What is the InChIKey of 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide?
The InChIKey is JALGWBVSXNDKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O4S2/c12-10(16)6-2-1-3-7(11(13)17)9(6)15-21(18,19)8-4-20-5-14-8/h1-5,15H,(H2,12,16)(H2,13,17).
What are the key properties of 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide?
2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide has a molecular weight of 326.36 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-4-ylsulfonylamino)benzene-1,3-dicarboxamide is sourced from PubChem (CID 90791952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).