C35H52N2O5Si — CID 90792305
tert-butyl 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoate (PubChem CID 90792305) has the molecular formula C35H52N2O5Si and a molecular weight of 608.90 g/mol. Its IUPAC name is tert-butyl 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoate.
| Compound Name | tert-butyl 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoate |
|---|---|
| PubChem CID | 90792305 |
| Molecular Formula | C35H52N2O5Si |
| Molecular Weight | 608.90 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | tert-butyl 7-(2-ethyl-1,3-dioxolan-2-yl)-2-[5-naphthalen-2-yl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]heptanoate |
| SMILES | CCC1(CCCCCC(C(=O)OC(C)(C)C)c2ncc(-c3ccc4ccccc4c3)n2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C35H52N2O5Si/c1-8-35(40-20-21-41-35)19-13-9-10-16-30(33(38)42-34(2,3)4)32-36-25-31(37(32)26-39-22-23-43(5,6)7)29-18-17-27-14-11-12-15-28(27)24-29/h11-12,14-15,17-18,24-25,30H,8-10,13,16,19-23,26H2,1-7H3 |
| InChIKey | XJMPMLKPKLGNEF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.90 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|