C31H34Cl2N6O2 — CID 90792742
(4R)-4-[N-(N'-cyanocarbamimidoyl)-4-(3,4-dichlorophenoxy)anilino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide (PubChem CID 90792742) has the molecular formula C31H34Cl2N6O2 and a molecular weight of 593.56 g/mol. Its IUPAC name is (4R)-4-[N-(N'-cyanocarbamimidoyl)-4-(3,4-dichlorophenoxy)anilino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide.
| Compound Name | (4R)-4-[N-(N'-cyanocarbamimidoyl)-4-(3,4-dichlorophenoxy)anilino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide |
|---|---|
| PubChem CID | 90792742 |
| Molecular Formula | C31H34Cl2N6O2 |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | (4R)-4-[N-(N'-cyanocarbamimidoyl)-4-(3,4-dichlorophenoxy)anilino]-5-phenyl-N-(2-pyrrolidin-1-ylethyl)pentanamide |
| SMILES | N#C/N=C(\N)N(c1ccc(Oc2ccc(Cl)c(Cl)c2)cc1)[C@H](CCC(=O)NCCN1CCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C31H34Cl2N6O2/c32-28-14-13-27(21-29(28)33)41-26-11-8-24(9-12-26)39(31(35)37-22-34)25(20-23-6-2-1-3-7-23)10-15-30(40)36-16-19-38-17-4-5-18-38/h1-3,6-9,11-14,21,25H,4-5,10,15-20H2,(H2,35,37)(H,36,40)/t25-/m1/s1 |
| InChIKey | QXKKROIYEZCYNG-RUZDIDTESA-N |
| XLogP | 5.99 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|