C24H35FN3O9P — CID 90793346
[2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 90793346) has the molecular formula C24H35FN3O9P and a molecular weight of 559.53 g/mol. Its IUPAC name is [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90793346 |
| Molecular Formula | C24H35FN3O9P |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CC(O)Cn2c(O)c3c(c2O)CC(OP(=O)(O)O)C(O)C3)CC1 |
| InChI | InChI=1S/C24H35FN3O9P/c1-14(2)36-21-4-3-15(25)9-19(21)27-7-5-26(6-8-27)12-16(29)13-28-23(31)17-10-20(30)22(37-38(33,34)35)11-18(17)24(28)32/h3-4,9,14,16,20,22,29-32H,5-8,10-13H2,1-2H3,(H2,33,34,35) |
| InChIKey | AADZDQSWFXVYMV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|