C23H26FNO2 — CID 90793690
4-(4-fluorophenyl)-3-pent-2-enyl-4-phenylmethoxypiperidin-2-one (PubChem CID 90793690) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-pent-2-enyl-4-phenylmethoxypiperidin-2-one.
| Compound Name | 4-(4-fluorophenyl)-3-pent-2-enyl-4-phenylmethoxypiperidin-2-one |
|---|---|
| PubChem CID | 90793690 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-(4-fluorophenyl)-3-pent-2-enyl-4-phenylmethoxypiperidin-2-one |
| SMILES | CCC=CCC1C(=O)NCCC1(OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FNO2/c1-2-3-5-10-21-22(26)25-16-15-23(21,19-11-13-20(24)14-12-19)27-17-18-8-6-4-7-9-18/h3-9,11-14,21H,2,10,15-17H2,1H3,(H,25,26) |
| InChIKey | NLEKVLUJFKSKQB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|