C26H36FN3O6 — CID 90794713
2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol (PubChem CID 90794713) has the molecular formula C26H36FN3O6 and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol.
| Compound Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 90794713 |
| Molecular Formula | C26H36FN3O6 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
| SMILES | Oc1c2c(c(O)n1CC(O)CN1CCN(c3cc(F)ccc3OC3CCCC3)CC1)CC(O)C(O)C2 |
| InChI | InChI=1S/C26H36FN3O6/c27-16-5-6-24(36-18-3-1-2-4-18)21(11-16)29-9-7-28(8-10-29)14-17(31)15-30-25(34)19-12-22(32)23(33)13-20(19)26(30)35/h5-6,11,17-18,22-23,31-35H,1-4,7-10,12-15H2 |
| InChIKey | ZERJKSINUFHVFS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |