C27H32N2O6Si — CID 90794733
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-4,7-epoxyisoindole-1,3-diol (PubChem CID 90794733) has the molecular formula C27H32N2O6Si and a molecular weight of 508.65 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90794733 |
| Molecular Formula | C27H32N2O6Si |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-4,7-epoxyisoindole-1,3-diol |
| SMILES | CC12C=CC(CCO[Si](C)(C)C(C)(C)C)(O1)c1c2c(O)n(-c2ccc([N+](=O)[O-])c3ccccc23)c1O |
| InChI | InChI=1S/C27H32N2O6Si/c1-25(2,3)36(5,6)34-16-15-27-14-13-26(4,35-27)21-22(27)24(31)28(23(21)30)19-11-12-20(29(32)33)18-10-8-7-9-17(18)19/h7-14,30-31H,15-16H2,1-6H3 |
| InChIKey | MDOGNACSCNRYQZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|