About 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine
4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine (PubChem CID 90794912) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine.
Molecular Properties
| Compound Name | 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine |
| PubChem CID | 90794912 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine |
| SMILES | c1ccc2c(c1)OCN=C2c1ccnc2ccncc12 |
| InChI | InChI=1S/C16H11N3O/c1-2-4-15-12(3-1)16(19-10-20-15)11-5-8-18-14-6-7-17-9-13(11)14/h1-9H,10H2 |
| InChIKey | MUSUWCRFYATRDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine?
The IUPAC name of 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine (CID 90794912) is 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine.
What is the SMILES notation for 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine?
The canonical SMILES for 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine is c1ccc2c(c1)OCN=C2c1ccnc2ccncc12.
What is the InChIKey of 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine?
The InChIKey is MUSUWCRFYATRDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O/c1-2-4-15-12(3-1)16(19-10-20-15)11-5-8-18-14-6-7-17-9-13(11)14/h1-9H,10H2.
What are the key properties of 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine?
4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine has a molecular weight of 261.28 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,6-naphthyridin-4-yl)-2H-1,3-benzoxazine is sourced from PubChem (CID 90794912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).