C27H22NO4+ — CID 90794980
16-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene (PubChem CID 90794980) has the molecular formula C27H22NO4+ and a molecular weight of 424.48 g/mol. Its IUPAC name is 16-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene.
| Compound Name | 16-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene |
|---|---|
| PubChem CID | 90794980 |
| Molecular Formula | C27H22NO4+ |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 16-benzyl-24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene |
| SMILES | C[n+]1cc2c3c(c(Cc4ccccc4)cc2c2c1-c1cc4c(cc1CC2)OCO4)OCO3 |
| InChI | InChI=1S/C27H22NO4/c1-28-13-22-21(10-18(26-27(22)32-15-31-26)9-16-5-3-2-4-6-16)19-8-7-17-11-23-24(30-14-29-23)12-20(17)25(19)28/h2-6,10-13H,7-9,14-15H2,1H3/q+1 |
| InChIKey | DBCFBPLSLPYGDR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|