About ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane
ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane (PubChem CID 90795014) has the molecular formula C17H18F3NO4S
and a molecular weight of 389.40 g/mol. Its IUPAC name is ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane |
| PubChem CID | 90795014 |
| Molecular Formula | C17H18F3NO4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane |
| SMILES | CC1OCCO1.CCOC(=O)c1sc(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO2S.C4H8O2/c1-2-19-12(18)9-10(13(14,15)16)17-11(20-9)8-6-4-3-5-7-8;1-4-5-2-3-6-4/h3-7H,2H2,1H3;4H,2-3H2,1H3 |
| InChIKey | CHGPAKFMQCEMHO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane?
The IUPAC name of ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane (CID 90795014) is ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane.
What is the SMILES notation for ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane?
The canonical SMILES for ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane is CC1OCCO1.CCOC(=O)c1sc(-c2ccccc2)nc1C(F)(F)F.
What is the InChIKey of ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane?
The InChIKey is CHGPAKFMQCEMHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO2S.C4H8O2/c1-2-19-12(18)9-10(13(14,15)16)17-11(20-9)8-6-4-3-5-7-8;1-4-5-2-3-6-4/h3-7H,2H2,1H3;4H,2-3H2,1H3.
What are the key properties of ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane?
ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane has a molecular weight of 389.40 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate;2-methyl-1,3-dioxolane is sourced from PubChem (CID 90795014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).