About 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile
5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile (PubChem CID 90795210) has the molecular formula C12H11NO4S
and a molecular weight of 265.29 g/mol. Its IUPAC name is 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile |
| PubChem CID | 90795210 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile |
| SMILES | CS(=O)(=O)C(C#N)=CC=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H11NO4S/c1-18(16,17)10(8-13)4-2-3-9-5-6-11(14)12(15)7-9/h2-7,14-15H,1H3 |
| InChIKey | HHLIUUANULQOHD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile?
The IUPAC name of 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile (CID 90795210) is 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile.
What is the SMILES notation for 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile?
The canonical SMILES for 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile is CS(=O)(=O)C(C#N)=CC=Cc1ccc(O)c(O)c1.
What is the InChIKey of 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile?
The InChIKey is HHLIUUANULQOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4S/c1-18(16,17)10(8-13)4-2-3-9-5-6-11(14)12(15)7-9/h2-7,14-15H,1H3.
What are the key properties of 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile?
5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile has a molecular weight of 265.29 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydroxyphenyl)-2-methylsulfonylpenta-2,4-dienenitrile is sourced from PubChem (CID 90795210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).