C26H19F5N2O2 — CID 90795266
1-[2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone (PubChem CID 90795266) has the molecular formula C26H19F5N2O2 and a molecular weight of 486.44 g/mol. Its IUPAC name is 1-[2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone.
| Compound Name | 1-[2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 90795266 |
| Molecular Formula | C26H19F5N2O2 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-[2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1ccc2nc(C=Cc3ccc(OCC(F)(F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H19F5N2O2/c1-16(34)20-4-2-3-5-21(20)18-9-12-22-23(14-18)33-24(32-22)13-8-17-6-10-19(11-7-17)35-15-25(27,28)26(29,30)31/h2-14H,15H2,1H3,(H,32,33) |
| InChIKey | NCUKYYGIZDMUSA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|