C25H25F5N5O4S+ — CID 90795382
N-[2,6-dimethyl-3-[[4-[2-(2,2,3,3,4-pentafluorobutanoyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 90795382) has the molecular formula C25H25F5N5O4S+ and a molecular weight of 586.56 g/mol. Its IUPAC name is N-[2,6-dimethyl-3-[[4-[2-(2,2,3,3,4-pentafluorobutanoyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[2,6-dimethyl-3-[[4-[2-(2,2,3,3,4-pentafluorobutanoyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 90795382 |
| Molecular Formula | C25H25F5N5O4S+ |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | N-[2,6-dimethyl-3-[[4-[2-(2,2,3,3,4-pentafluorobutanoyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NNC(=O)C(F)(F)C(F)(F)CF)cc2)c(C)c1NC(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C25H24F5N5O4S/c1-16-6-11-20(17(2)22(16)31-21(36)14-35-12-4-3-5-13-35)40(38,39)34-19-9-7-18(8-10-19)32-33-23(37)25(29,30)24(27,28)15-26/h3-13,32,34H,14-15H2,1-2H3,(H-,31,33,36,37)/p+1 |
| InChIKey | KIYCTQKROSTRMQ-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|