C44H68O8Si — CID 90795667
(2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enoic acid (PubChem CID 90795667) has the molecular formula C44H68O8Si and a molecular weight of 753.11 g/mol. Its IUPAC name is (2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enoic acid.
| Compound Name | (2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enoic acid |
|---|---|
| PubChem CID | 90795667 |
| Molecular Formula | C44H68O8Si |
| Molecular Weight | 753.11 g/mol |
| Exact Mass | 752.47 |
| IUPAC Name | (2S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enoic acid |
| SMILES | CCCCCCCC1(CCCCCCC=C[C@H](C(=O)O)[C@@](O)(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)OC(C)(C)C)OCCO1 |
| InChI | InChI=1S/C44H68O8Si/c1-8-9-10-14-23-30-43(49-34-35-50-43)31-24-15-12-11-13-22-29-38(39(45)46)44(48,40(47)52-41(2,3)4)32-33-51-53(42(5,6)7,36-25-18-16-19-26-36)37-27-20-17-21-28-37/h16-22,25-29,38,48H,8-15,23-24,30-35H2,1-7H3,(H,45,46)/t38-,44+/m1/s1 |
| InChIKey | MWEISLIREZZAFH-YWZTWLIPSA-N |
| XLogP | 8.73 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.11 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|