About 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde
2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde (PubChem CID 90795713) has the molecular formula C11H14F2O2
and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde |
| PubChem CID | 90795713 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde |
| SMILES | CC(C)(O)C1=CC(F)C(CC=O)C(F)=C1 |
| InChI | InChI=1S/C11H14F2O2/c1-11(2,15)7-5-9(12)8(3-4-14)10(13)6-7/h4-6,8-9,15H,3H2,1-2H3 |
| InChIKey | LLLANUZKAUSEJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde?
The IUPAC name of 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde (CID 90795713) is 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde.
What is the SMILES notation for 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde?
The canonical SMILES for 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde is CC(C)(O)C1=CC(F)C(CC=O)C(F)=C1.
What is the InChIKey of 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde?
The InChIKey is LLLANUZKAUSEJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O2/c1-11(2,15)7-5-9(12)8(3-4-14)10(13)6-7/h4-6,8-9,15H,3H2,1-2H3.
What are the key properties of 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde?
2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde has a molecular weight of 216.23 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-difluoro-4-(2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]acetaldehyde is sourced from PubChem (CID 90795713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).