C20H32N2O3 — CID 90796180
but-2-yne;ethane;N-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 90796180) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is but-2-yne;ethane;N-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | but-2-yne;ethane;N-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 90796180 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | but-2-yne;ethane;N-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC.CC.CC#CC.CC(=O)NC[C@H]1CN(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H14N2O3.C4H6.2C2H6/c1-9(15)13-7-11-8-14(12(16)17-11)10-5-3-2-4-6-10;1-3-4-2;2*1-2/h2-6,11H,7-8H2,1H3,(H,13,15);1-2H3;2*1-2H3/t11-;;;/m0.../s1 |
| InChIKey | CWFXGUJOQZQGJH-XVSRHIFFSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|