C18H36 — CID 90796396
2,2,4,4,7,7,9,9-octamethyldec-5-ene (PubChem CID 90796396) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9-octamethyldec-5-ene.
| Compound Name | 2,2,4,4,7,7,9,9-octamethyldec-5-ene |
|---|---|
| PubChem CID | 90796396 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 2,2,4,4,7,7,9,9-octamethyldec-5-ene |
| SMILES | CC(C)(C)CC(C)(C)C=CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H36/c1-15(2,3)13-17(7,8)11-12-18(9,10)14-16(4,5)6/h11-12H,13-14H2,1-10H3 |
| InChIKey | AENCIPYWPDOKBN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|