C18H15F2NO4 — CID 90796668
methyl 3-(2,6-difluorophenyl)-2-phenylmethoxycarbonyliminopropanoate (PubChem CID 90796668) has the molecular formula C18H15F2NO4 and a molecular weight of 347.32 g/mol. Its IUPAC name is methyl 3-(2,6-difluorophenyl)-2-phenylmethoxycarbonyliminopropanoate.
| Compound Name | methyl 3-(2,6-difluorophenyl)-2-phenylmethoxycarbonyliminopropanoate |
|---|---|
| PubChem CID | 90796668 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl 3-(2,6-difluorophenyl)-2-phenylmethoxycarbonyliminopropanoate |
| SMILES | COC(=O)C(Cc1c(F)cccc1F)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H15F2NO4/c1-24-17(22)16(10-13-14(19)8-5-9-15(13)20)21-18(23)25-11-12-6-3-2-4-7-12/h2-9H,10-11H2,1H3 |
| InChIKey | PGIQSSUSUQKFNP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|