C12H21NO — CID 90796927
5-methoxy-3,8-dimethylnona-3,5,7-trien-1-amine (PubChem CID 90796927) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-methoxy-3,8-dimethylnona-3,5,7-trien-1-amine.
| Compound Name | 5-methoxy-3,8-dimethylnona-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 90796927 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-methoxy-3,8-dimethylnona-3,5,7-trien-1-amine |
| SMILES | COC(C=C(C)CCN)=CC=C(C)C |
| InChI | InChI=1S/C12H21NO/c1-10(2)5-6-12(14-4)9-11(3)7-8-13/h5-6,9H,7-8,13H2,1-4H3 |
| InChIKey | WRQPKIKHKRKBDS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|