C28H32N4O — CID 90797033
2-[(4-ethylphenyl)methyl]-7-methyl-5-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]isoindol-1-ol (PubChem CID 90797033) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-7-methyl-5-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]isoindol-1-ol.
| Compound Name | 2-[(4-ethylphenyl)methyl]-7-methyl-5-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90797033 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-7-methyl-5-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]isoindol-1-ol |
| SMILES | CCc1ccc(Cn2cc3cc(-c4ccc(N5CCN(C)CC5)nc4)cc(C)c3c2O)cc1 |
| InChI | InChI=1S/C28H32N4O/c1-4-21-5-7-22(8-6-21)18-32-19-25-16-24(15-20(2)27(25)28(32)33)23-9-10-26(29-17-23)31-13-11-30(3)12-14-31/h5-10,15-17,19,33H,4,11-14,18H2,1-3H3 |
| InChIKey | ZBINRVSKQOITEL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |