C25H44O6Si — CID 90797378
3-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-[(2R)-oxiran-2-yl]but-3-enoxy]propyl 2,2-dimethylpropanoate;trimethyl(prop-1-ynyl)silane (PubChem CID 90797378) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is 3-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-[(2R)-oxiran-2-yl]but-3-enoxy]propyl 2,2-dimethylpropanoate;trimethyl(prop-1-ynyl)silane.
| Compound Name | 3-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-[(2R)-oxiran-2-yl]but-3-enoxy]propyl 2,2-dimethylpropanoate;trimethyl(prop-1-ynyl)silane |
|---|---|
| PubChem CID | 90797378 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-[(2R)-oxiran-2-yl]but-3-enoxy]propyl 2,2-dimethylpropanoate;trimethyl(prop-1-ynyl)silane |
| SMILES | C=CC(OC(=O)C(C)(C)C)[C@H](OCCCOC(=O)C(C)(C)C)[C@H]1CO1.CC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H32O6.C6H12Si/c1-8-13(25-17(21)19(5,6)7)15(14-12-24-14)22-10-9-11-23-16(20)18(2,3)4;1-5-6-7(2,3)4/h8,13-15H,1,9-12H2,2-7H3;1-4H3/t13?,14-,15+;/m1./s1 |
| InChIKey | NXKVFXOCITUXBQ-OFYGOMGKSA-N |
| XLogP | 4.78 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|