C24H36FNO5S — CID 90797452
ethyl 7-[(1R,2R,5S)-2-[(3R)-4-(4-fluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate (PubChem CID 90797452) has the molecular formula C24H36FNO5S and a molecular weight of 469.62 g/mol. Its IUPAC name is ethyl 7-[(1R,2R,5S)-2-[(3R)-4-(4-fluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2R,5S)-2-[(3R)-4-(4-fluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 90797452 |
| Molecular Formula | C24H36FNO5S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl 7-[(1R,2R,5S)-2-[(3R)-4-(4-fluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCC[C@H]1[C@@H](O)CC(N=O)[C@@H]1CC[C@@H](O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C24H36FNO5S/c1-2-31-24(29)8-6-4-3-5-7-21-20(22(26-30)15-23(21)28)14-11-18(27)16-32-19-12-9-17(25)10-13-19/h9-10,12-13,18,20-23,27-28H,2-8,11,14-16H2,1H3/t18-,20-,21-,22?,23+/m1/s1 |
| InChIKey | AOSNEZIGQCNVPN-IWSFFNPRSA-N |
| XLogP | 5.09 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|