C32H28N3O2+ — CID 90797771
2-[[2-hydroxy-3-(1-methyl-2-phenylindol-1-ium-3-ylidene)-4-oxocyclobutyl]methylidene]-1,3,3-trimethylindole-5-carbonitrile (PubChem CID 90797771) has the molecular formula C32H28N3O2+ and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-(1-methyl-2-phenylindol-1-ium-3-ylidene)-4-oxocyclobutyl]methylidene]-1,3,3-trimethylindole-5-carbonitrile.
| Compound Name | 2-[[2-hydroxy-3-(1-methyl-2-phenylindol-1-ium-3-ylidene)-4-oxocyclobutyl]methylidene]-1,3,3-trimethylindole-5-carbonitrile |
|---|---|
| PubChem CID | 90797771 |
| Molecular Formula | C32H28N3O2+ |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 2-[[2-hydroxy-3-(1-methyl-2-phenylindol-1-ium-3-ylidene)-4-oxocyclobutyl]methylidene]-1,3,3-trimethylindole-5-carbonitrile |
| SMILES | CN1C(=CC2C(=O)C(=C3C(c4ccccc4)=[N+](C)c4ccccc43)C2O)C(C)(C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C32H28N3O2/c1-32(2)23-16-19(18-33)14-15-25(23)34(3)26(32)17-22-30(36)28(31(22)37)27-21-12-8-9-13-24(21)35(4)29(27)20-10-6-5-7-11-20/h5-17,22,30,36H,1-4H3/q+1 |
| InChIKey | CFMCAHPCPXYHBT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|