C10H15NO2 — CID 90797819
1-methyl-1,2,3,4,4a,5,8,8a-octahydroisoquinoline-6,7-dione (PubChem CID 90797819) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-methyl-1,2,3,4,4a,5,8,8a-octahydroisoquinoline-6,7-dione.
| Compound Name | 1-methyl-1,2,3,4,4a,5,8,8a-octahydroisoquinoline-6,7-dione |
|---|---|
| PubChem CID | 90797819 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-methyl-1,2,3,4,4a,5,8,8a-octahydroisoquinoline-6,7-dione |
| SMILES | CC1NCCC2CC(=O)C(=O)CC21 |
| InChI | InChI=1S/C10H15NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h6-8,11H,2-5H2,1H3 |
| InChIKey | GFWCXULIZIKATJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|