C16H25N5 — CID 90798639
N'-(2-aminoethyl)-N'-[2-(quinolin-4-ylmethylamino)ethyl]ethane-1,2-diamine (PubChem CID 90798639) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-[2-(quinolin-4-ylmethylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-[2-(quinolin-4-ylmethylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 90798639 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N'-(2-aminoethyl)-N'-[2-(quinolin-4-ylmethylamino)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CCN)CCNCc1ccnc2ccccc12 |
| InChI | InChI=1S/C16H25N5/c17-6-10-21(11-7-18)12-9-19-13-14-5-8-20-16-4-2-1-3-15(14)16/h1-5,8,19H,6-7,9-13,17-18H2 |
| InChIKey | XCDJAVHBTZSSTM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|